C22H15N3O7 — CID 19122479
[2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 19122479) has the molecular formula C22H15N3O7 and a molecular weight of 433.38 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 19122479 |
| Molecular Formula | C22H15N3O7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccccc3[N+](=O)[O-])ccc2C1c1ccco1 |
| InChI | InChI=1S/C22H15N3O7/c23-11-15-21(18-6-3-9-29-18)14-8-7-13(10-19(14)32-22(15)24)31-20(26)12-30-17-5-2-1-4-16(17)25(27)28/h1-10,21H,12,24H2 |
| InChIKey | BZGWDKNDANIENE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|