C27H23N3O9 — CID 19123438
[2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 19123438) has the molecular formula C27H23N3O9 and a molecular weight of 533.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 19123438 |
| Molecular Formula | C27H23N3O9 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4[N+](=O)[O-])ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C27H23N3O9/c1-34-22-10-15(11-23(35-2)26(22)36-3)25-17-9-8-16(12-21(17)39-27(29)18(25)13-28)38-24(31)14-37-20-7-5-4-6-19(20)30(32)33/h4-12,25H,14,29H2,1-3H3 |
| InChIKey | QEQFRMQGGSKOIX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|