C27H24N2O7 — CID 19123435
[2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-phenoxyacetate (PubChem CID 19123435) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-phenoxyacetate.
| Compound Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 19123435 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-phenoxyacetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C27H24N2O7/c1-31-22-11-16(12-23(32-2)26(22)33-3)25-19-10-9-18(13-21(19)36-27(29)20(25)14-28)35-24(30)15-34-17-7-5-4-6-8-17/h4-13,25H,15,29H2,1-3H3 |
| InChIKey | TXPBYGBDHATUNX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|