C28H24N2O6 — CID 19123446
[2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] (E)-3-phenylprop-2-enoate (PubChem CID 19123446) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 19123446 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccccc4)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C28H24N2O6/c1-32-23-13-18(14-24(33-2)27(23)34-3)26-20-11-10-19(15-22(20)36-28(30)21(26)16-29)35-25(31)12-9-17-7-5-4-6-8-17/h4-15,26H,30H2,1-3H3/b12-9+ |
| InChIKey | BAJCWVBGVYOJAL-FMIVXFBMSA-N |
| XLogP | 4.55 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|