C34H28N2O5 — CID 19123123
[2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 19123123) has the molecular formula C34H28N2O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19123123 |
| Molecular Formula | C34H28N2O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(C)cc4)ccc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H28N2O5/c1-22-8-10-23(11-9-22)12-17-32(37)40-26-14-15-27-30(19-26)41-34(36)28(20-35)33(27)25-13-16-29(31(18-25)38-2)39-21-24-6-4-3-5-7-24/h3-19,33H,21,36H2,1-2H3/b17-12+ |
| InChIKey | GYDWYMQGKMYEQT-SFQUDFHCSA-N |
| XLogP | 6.42 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|