C28H23ClN2O5 — CID 19122962
[2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19122962) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19122962 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(Cl)cc4)ccc32)cc1OC |
| InChI | InChI=1S/C28H23ClN2O5/c1-3-34-23-12-7-18(14-25(23)33-2)27-21-11-10-20(15-24(21)36-28(31)22(27)16-30)35-26(32)13-6-17-4-8-19(29)9-5-17/h4-15,27H,3,31H2,1-2H3/b13-6+ |
| InChIKey | JPYJISDJEWMIOY-AWNIVKPZSA-N |
| XLogP | 5.58 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|