C33H24ClFN2O5 — CID 19127278
[2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19127278) has the molecular formula C33H24ClFN2O5 and a molecular weight of 583.02 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19127278 |
| Molecular Formula | C33H24ClFN2O5 |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(Cl)cc4)ccc32)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C33H24ClFN2O5/c1-39-30-16-22(7-14-28(30)40-19-21-4-10-24(35)11-5-21)32-26-13-12-25(17-29(26)42-33(37)27(32)18-36)41-31(38)15-6-20-2-8-23(34)9-3-20/h2-17,32H,19,37H2,1H3/b15-6+ |
| InChIKey | HWDTYHNDTQESQV-GIDUJCDVSA-N |
| XLogP | 6.90 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|