C33H27ClN2O6 — CID 19127170
[2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate (PubChem CID 19127170) has the molecular formula C33H27ClN2O6 and a molecular weight of 583.04 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 19127170 |
| Molecular Formula | C33H27ClN2O6 |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(Cl)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C33H27ClN2O6/c1-38-24-10-5-20(6-11-24)15-31(37)41-25-12-13-26-29(17-25)42-33(36)27(18-35)32(26)22-7-14-28(30(16-22)39-2)40-19-21-3-8-23(34)9-4-21/h3-14,16-17,32H,15,19,36H2,1-2H3 |
| InChIKey | NSCVBYAGDKLZNO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|