C32H25FN2O6 — CID 19127261
[2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-methoxybenzoate (PubChem CID 19127261) has the molecular formula C32H25FN2O6 and a molecular weight of 552.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-methoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 19127261 |
| Molecular Formula | C32H25FN2O6 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(F)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H25FN2O6/c1-37-23-10-5-20(6-11-23)32(36)40-24-12-13-25-28(16-24)41-31(35)26(17-34)30(25)21-7-14-27(29(15-21)38-2)39-18-19-3-8-22(33)9-4-19/h3-16,30H,18,35H2,1-2H3 |
| InChIKey | JCSRUECZPDBPHD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|