C34H29FN2O6 — CID 19127804
[2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-ethoxybenzoate (PubChem CID 19127804) has the molecular formula C34H29FN2O6 and a molecular weight of 580.61 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-ethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 19127804 |
| Molecular Formula | C34H29FN2O6 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-ethoxybenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4OCC)ccc32)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C34H29FN2O6/c1-3-39-28-8-6-5-7-26(28)34(38)42-24-14-15-25-30(18-24)43-33(37)27(19-36)32(25)22-11-16-29(31(17-22)40-4-2)41-20-21-9-12-23(35)13-10-21/h5-18,32H,3-4,20,37H2,1-2H3 |
| InChIKey | GPBKZMPZXVGEKR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|