C35H31FN2O6 — CID 19127462
[2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate (PubChem CID 19127462) has the molecular formula C35H31FN2O6 and a molecular weight of 594.64 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 19127462 |
| Molecular Formula | C35H31FN2O6 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(C)Oc4ccccc4F)ccc32)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C35H31FN2O6/c1-4-40-32-17-24(13-16-30(32)41-20-23-11-9-21(2)10-12-23)33-26-15-14-25(18-31(26)44-34(38)27(33)19-37)43-35(39)22(3)42-29-8-6-5-7-28(29)36/h5-18,22,33H,4,20,38H2,1-3H3 |
| InChIKey | LWZXVIHNOLPCGH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|