C29H27FN2O5 — CID 19124761
[2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-fluorobenzoate (PubChem CID 19124761) has the molecular formula C29H27FN2O5 and a molecular weight of 502.54 g/mol. Its IUPAC name is [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-fluorobenzoate.
| Compound Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 19124761 |
| Molecular Formula | C29H27FN2O5 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-fluorobenzoate |
| SMILES | CCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4F)ccc32)cc1OCC |
| InChI | InChI=1S/C29H27FN2O5/c1-3-5-14-35-24-13-10-18(15-26(24)34-4-2)27-21-12-11-19(16-25(21)37-28(32)22(27)17-31)36-29(33)20-8-6-7-9-23(20)30/h6-13,15-16,27H,3-5,14,32H2,1-2H3 |
| InChIKey | GPENNAAUBHVLFC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|