C33H34N2O6 — CID 19124904
[2-amino-3-cyano-4-(3-ethoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 4-prop-2-enoxybenzoate (PubChem CID 19124904) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-ethoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 4-prop-2-enoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-ethoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 19124904 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [2-amino-3-cyano-4-(3-ethoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCCCCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C33H34N2O6/c1-4-7-8-18-39-28-16-11-23(19-30(28)37-6-3)31-26-15-14-25(20-29(26)41-32(35)27(31)21-34)40-33(36)22-9-12-24(13-10-22)38-17-5-2/h5,9-16,19-20,31H,2,4,6-8,17-18,35H2,1,3H3 |
| InChIKey | SGAJAUXRPAGWIN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|