C33H36N2O6 — CID 19124983
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-propan-2-yloxybenzoate (PubChem CID 19124983) has the molecular formula C33H36N2O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-propan-2-yloxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 19124983 |
| Molecular Formula | C33H36N2O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-propan-2-yloxybenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(OC(C)C)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H36N2O6/c1-6-37-30-17-23(9-14-28(30)38-16-15-20(2)3)31-26-13-12-25(18-29(26)41-32(35)27(31)19-34)40-33(36)22-7-10-24(11-8-22)39-21(4)5/h7-14,17-18,20-21,31H,6,15-16,35H2,1-5H3 |
| InChIKey | GMURQHSXGXYBIW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|