C34H38N2O6 — CID 19125004
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 19125004) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19125004 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(C(C)C)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C34H38N2O6/c1-6-38-31-17-24(9-14-29(31)39-16-15-21(2)3)33-27-13-12-26(18-30(27)42-34(36)28(33)19-35)41-32(37)20-40-25-10-7-23(8-11-25)22(4)5/h7-14,17-18,21-22,33H,6,15-16,20,36H2,1-5H3 |
| InChIKey | RBFITMRUKDPPQA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|