C34H38N2O6 — CID 19124753
[2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 19124753) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 19124753 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | CCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(C(C)(C)C)cc4)ccc32)cc1OCC |
| InChI | InChI=1S/C34H38N2O6/c1-6-8-17-39-28-16-9-22(18-30(28)38-7-2)32-26-15-14-25(19-29(26)42-33(36)27(32)20-35)41-31(37)21-40-24-12-10-23(11-13-24)34(3,4)5/h9-16,18-19,32H,6-8,17,21,36H2,1-5H3 |
| InChIKey | VBEHVDDHHJXTJK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|