C30H25Cl5N2O6 — CID 19123331
[2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19123331) has the molecular formula C30H25Cl5N2O6 and a molecular weight of 686.80 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19123331 |
| Molecular Formula | C30H25Cl5N2O6 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 684.02 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | CCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)ccc32)cc1OC |
| InChI | InChI=1S/C30H25Cl5N2O6/c1-3-4-5-10-40-19-9-6-15(11-21(19)39-2)23-17-8-7-16(12-20(17)43-30(37)18(23)13-36)42-22(38)14-41-29-27(34)25(32)24(31)26(33)28(29)35/h6-9,11-12,23H,3-5,10,14,37H2,1-2H3 |
| InChIKey | CNEVVLRMEPUTRX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|