C25H15Cl5N2O5 — CID 19121096
[2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19121096) has the molecular formula C25H15Cl5N2O5 and a molecular weight of 600.67 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19121096 |
| Molecular Formula | C25H15Cl5N2O5 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 597.94 |
| IUPAC Name | [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H15Cl5N2O5/c1-34-12-4-2-11(3-5-12)18-14-7-6-13(8-16(14)37-25(32)15(18)9-31)36-17(33)10-35-24-22(29)20(27)19(26)21(28)23(24)30/h2-8,18H,10,32H2,1H3 |
| InChIKey | XQCRJMBUAZPLIU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|