C28H24N2O6 — CID 19124579
methyl 4-[2-amino-3-cyano-7-[2-(2,6-dimethylphenoxy)acetyl]oxy-4H-chromen-4-yl]benzoate (PubChem CID 19124579) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-7-[2-(2,6-dimethylphenoxy)acetyl]oxy-4H-chromen-4-yl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-7-[2-(2,6-dimethylphenoxy)acetyl]oxy-4H-chromen-4-yl]benzoate |
|---|---|
| PubChem CID | 19124579 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-7-[2-(2,6-dimethylphenoxy)acetyl]oxy-4H-chromen-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(C)cccc4C)ccc32)cc1 |
| InChI | InChI=1S/C28H24N2O6/c1-16-5-4-6-17(2)26(16)34-15-24(31)35-20-11-12-21-23(13-20)36-27(30)22(14-29)25(21)18-7-9-19(10-8-18)28(32)33-3/h4-13,25H,15,30H2,1-3H3 |
| InChIKey | KXOODHUBXNUNAH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|