C26H20N2O5 — CID 19124615
methyl 4-[2-amino-3-cyano-7-(2-phenylacetyl)oxy-4H-chromen-4-yl]benzoate (PubChem CID 19124615) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-7-(2-phenylacetyl)oxy-4H-chromen-4-yl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-7-(2-phenylacetyl)oxy-4H-chromen-4-yl]benzoate |
|---|---|
| PubChem CID | 19124615 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-7-(2-phenylacetyl)oxy-4H-chromen-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C26H20N2O5/c1-31-26(30)18-9-7-17(8-10-18)24-20-12-11-19(14-22(20)33-25(28)21(24)15-27)32-23(29)13-16-5-3-2-4-6-16/h2-12,14,24H,13,28H2,1H3 |
| InChIKey | FAPTUWDPJGRXSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|