C27H22N2O4 — CID 19122696
[2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-phenylacetate (PubChem CID 19122696) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-phenylacetate.
| Compound Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 19122696 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-phenylacetate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C27H22N2O4/c1-2-14-31-20-10-8-19(9-11-20)26-22-13-12-21(16-24(22)33-27(29)23(26)17-28)32-25(30)15-18-6-4-3-5-7-18/h2-13,16,26H,1,14-15,29H2 |
| InChIKey | BIHAYCFACVLINI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|