C28H22N2O6 — CID 19128514
[2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 19128514) has the molecular formula C28H22N2O6 and a molecular weight of 482.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 19128514 |
| Molecular Formula | C28H22N2O6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)C4COc5ccccc5O4)ccc32)cc1 |
| InChI | InChI=1S/C28H22N2O6/c1-2-13-32-18-9-7-17(8-10-18)26-20-12-11-19(14-24(20)36-27(30)21(26)15-29)34-28(31)25-16-33-22-5-3-4-6-23(22)35-25/h2-12,14,25-26H,1,13,16,30H2 |
| InChIKey | ZQZQCBJGTPOFTA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|