C31H24N2O4 — CID 19125228
[2-amino-3-cyano-4-(3-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate (PubChem CID 19125228) has the molecular formula C31H24N2O4 and a molecular weight of 488.54 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-amino-3-cyano-4-(3-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 19125228 |
| Molecular Formula | C31H24N2O4 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [2-amino-3-cyano-4-(3-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
| SMILES | C=CCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4cccc5ccccc45)ccc32)c1 |
| InChI | InChI=1S/C31H24N2O4/c1-2-15-35-23-11-6-10-22(16-23)30-26-14-13-24(18-28(26)37-31(33)27(30)19-32)36-29(34)17-21-9-5-8-20-7-3-4-12-25(20)21/h2-14,16,18,30H,1,15,17,33H2 |
| InChIKey | NCRSSJMZJXOEQZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|