C31H26N2O3 — CID 19120754
[2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate (PubChem CID 19120754) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 19120754 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
| SMILES | CC(C)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4cccc5ccccc45)ccc32)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-19(2)20-10-12-22(13-11-20)30-26-15-14-24(17-28(26)36-31(33)27(30)18-32)35-29(34)16-23-8-5-7-21-6-3-4-9-25(21)23/h3-15,17,19,30H,16,33H2,1-2H3 |
| InChIKey | VIFNPDBWMMLIOE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|