C26H21ClN2O3 — CID 19120713
[2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-chlorobenzoate (PubChem CID 19120713) has the molecular formula C26H21ClN2O3 and a molecular weight of 444.92 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-chlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 19120713 |
| Molecular Formula | C26H21ClN2O3 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-chlorobenzoate |
| SMILES | CC(C)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C26H21ClN2O3/c1-15(2)16-7-9-17(10-8-16)24-20-12-11-18(13-23(20)32-25(29)21(24)14-28)31-26(30)19-5-3-4-6-22(19)27/h3-13,15,24H,29H2,1-2H3 |
| InChIKey | AXUUGXIWBRBXHJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|