C26H22N2O3 — CID 19120705
[2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] benzoate (PubChem CID 19120705) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] benzoate.
| Compound Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] benzoate |
|---|---|
| PubChem CID | 19120705 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] benzoate |
| SMILES | CC(C)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C26H22N2O3/c1-16(2)17-8-10-18(11-9-17)24-21-13-12-20(14-23(21)31-25(28)22(24)15-27)30-26(29)19-6-4-3-5-7-19/h3-14,16,24H,28H2,1-2H3 |
| InChIKey | SGAUONSEFZAQKP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|