C23H17N3O3 — CID 139582166
(2-amino-3-cyano-4-pyridin-4-yl-4H-chromen-7-yl) 2-methylbenzoate (PubChem CID 139582166) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is (2-amino-3-cyano-4-pyridin-4-yl-4H-chromen-7-yl) 2-methylbenzoate.
| Compound Name | (2-amino-3-cyano-4-pyridin-4-yl-4H-chromen-7-yl) 2-methylbenzoate |
|---|---|
| PubChem CID | 139582166 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2-amino-3-cyano-4-pyridin-4-yl-4H-chromen-7-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1ccncc1 |
| InChI | InChI=1S/C23H17N3O3/c1-14-4-2-3-5-17(14)23(27)28-16-6-7-18-20(12-16)29-22(25)19(13-24)21(18)15-8-10-26-11-9-15/h2-12,21H,25H2,1H3 |
| InChIKey | JVEUNGPEDXMEPV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|