C26H22N2O5 — CID 19125425
[2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 2-methoxybenzoate (PubChem CID 19125425) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 2-methoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 19125425 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 2-methoxybenzoate |
| SMILES | CCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4OC)ccc32)c1 |
| InChI | InChI=1S/C26H22N2O5/c1-3-31-17-8-6-7-16(13-17)24-19-12-11-18(14-23(19)33-25(28)21(24)15-27)32-26(29)20-9-4-5-10-22(20)30-2/h4-14,24H,3,28H2,1-2H3 |
| InChIKey | SUCHQEJUDYYGSB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|