C24H17BrN2O4 — CID 19120955
[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 2-bromobenzoate (PubChem CID 19120955) has the molecular formula C24H17BrN2O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 2-bromobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 2-bromobenzoate |
|---|---|
| PubChem CID | 19120955 |
| Molecular Formula | C24H17BrN2O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 2-bromobenzoate |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4Br)ccc32)c1 |
| InChI | InChI=1S/C24H17BrN2O4/c1-29-15-6-4-5-14(11-15)22-18-10-9-16(12-21(18)31-23(27)19(22)13-26)30-24(28)17-7-2-3-8-20(17)25/h2-12,22H,27H2,1H3 |
| InChIKey | DZJNAHNFFKNSTL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|