C17H13BrN2O2 — CID 8613713
(4S)-2-amino-4-(2-bromophenyl)-7-methoxy-4H-chromene-3-carbonitrile (PubChem CID 8613713) has the molecular formula C17H13BrN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is (4S)-2-amino-4-(2-bromophenyl)-7-methoxy-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(2-bromophenyl)-7-methoxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 8613713 |
| Molecular Formula | C17H13BrN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (4S)-2-amino-4-(2-bromophenyl)-7-methoxy-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc2c(c1)OC(N)=C(C#N)[C@H]2c1ccccc1Br |
| InChI | InChI=1S/C17H13BrN2O2/c1-21-10-6-7-12-15(8-10)22-17(20)13(9-19)16(12)11-4-2-3-5-14(11)18/h2-8,16H,20H2,1H3/t16-/m0/s1 |
| InChIKey | CUVWWADNNFAGSY-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |