C24H16BrClN2O3 — CID 19123893
[2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenyl)acetate (PubChem CID 19123893) has the molecular formula C24H16BrClN2O3 and a molecular weight of 495.76 g/mol. Its IUPAC name is [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 19123893 |
| Molecular Formula | C24H16BrClN2O3 |
| Molecular Weight | 495.76 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenyl)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)Cc3ccc(Cl)cc3)ccc2C1c1ccccc1Br |
| InChI | InChI=1S/C24H16BrClN2O3/c25-20-4-2-1-3-17(20)23-18-10-9-16(12-21(18)31-24(28)19(23)13-27)30-22(29)11-14-5-7-15(26)8-6-14/h1-10,12,23H,11,28H2 |
| InChIKey | JGUQMUJCIWCTMG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|