C25H19BrN2O4 — CID 19123894
[2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate (PubChem CID 19123894) has the molecular formula C25H19BrN2O4 and a molecular weight of 491.34 g/mol. Its IUPAC name is [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 19123894 |
| Molecular Formula | C25H19BrN2O4 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccccc2Br)cc1 |
| InChI | InChI=1S/C25H19BrN2O4/c1-30-16-8-6-15(7-9-16)12-23(29)31-17-10-11-19-22(13-17)32-25(28)20(14-27)24(19)18-4-2-3-5-21(18)26/h2-11,13,24H,12,28H2,1H3 |
| InChIKey | KJNYJUNVGZIEDU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|