C27H23BrN2O4 — CID 19123885
[2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 19123885) has the molecular formula C27H23BrN2O4 and a molecular weight of 519.40 g/mol. Its IUPAC name is [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19123885 |
| Molecular Formula | C27H23BrN2O4 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccccc2Br)cc1 |
| InChI | InChI=1S/C27H23BrN2O4/c1-16(2)17-7-9-18(10-8-17)32-15-25(31)33-19-11-12-21-24(13-19)34-27(30)22(14-29)26(21)20-5-3-4-6-23(20)28/h3-13,16,26H,15,30H2,1-2H3 |
| InChIKey | FFBDHEWQBOBJNL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|