C27H29BrN2O3 — CID 19128888
[2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19128888) has the molecular formula C27H29BrN2O3 and a molecular weight of 509.44 g/mol. Its IUPAC name is [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19128888 |
| Molecular Formula | C27H29BrN2O3 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | [2-amino-4-(2-bromophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccccc2Br)CC1 |
| InChI | InChI=1S/C27H29BrN2O3/c1-2-3-6-17-9-11-18(12-10-17)27(31)32-19-13-14-21-24(15-19)33-26(30)22(16-29)25(21)20-7-4-5-8-23(20)28/h4-5,7-8,13-15,17-18,25H,2-3,6,9-12,30H2,1H3 |
| InChIKey | VUOQZIBZRKCZBT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|