C27H28ClFN2O3 — CID 19128960
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19128960) has the molecular formula C27H28ClFN2O3 and a molecular weight of 482.98 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19128960 |
| Molecular Formula | C27H28ClFN2O3 |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C27H28ClFN2O3/c1-2-3-5-16-8-10-17(11-9-16)27(32)33-18-12-13-19-23(14-18)34-26(31)20(15-30)24(19)25-21(28)6-4-7-22(25)29/h4,6-7,12-14,16-17,24H,2-3,5,8-11,31H2,1H3 |
| InChIKey | KYHSGHAQSJJECM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|