C27H22ClFN2O4 — CID 19124107
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-(2-methylpropoxy)benzoate (PubChem CID 19124107) has the molecular formula C27H22ClFN2O4 and a molecular weight of 492.93 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 19124107 |
| Molecular Formula | C27H22ClFN2O4 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-(2-methylpropoxy)benzoate |
| SMILES | CC(C)COc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C27H22ClFN2O4/c1-15(2)14-33-17-8-6-16(7-9-17)27(32)34-18-10-11-19-23(12-18)35-26(31)20(13-30)24(19)25-21(28)4-3-5-22(25)29/h3-12,15,24H,14,31H2,1-2H3 |
| InChIKey | QIQWIBALZRCMOH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|