C28H25ClN2O4 — CID 19121467
[2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 4-pentoxybenzoate (PubChem CID 19121467) has the molecular formula C28H25ClN2O4 and a molecular weight of 488.97 g/mol. Its IUPAC name is [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 4-pentoxybenzoate.
| Compound Name | [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 19121467 |
| Molecular Formula | C28H25ClN2O4 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H25ClN2O4/c1-2-3-6-15-33-19-11-9-18(10-12-19)28(32)34-20-13-14-22-25(16-20)35-27(31)23(17-30)26(22)21-7-4-5-8-24(21)29/h4-5,7-14,16,26H,2-3,6,15,31H2,1H3 |
| InChIKey | PVKDJIMNVXZNDG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|