C25H18ClFN2O4 — CID 19124090
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-ethoxybenzoate (PubChem CID 19124090) has the molecular formula C25H18ClFN2O4 and a molecular weight of 464.88 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-ethoxybenzoate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 19124090 |
| Molecular Formula | C25H18ClFN2O4 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C25H18ClFN2O4/c1-2-31-15-8-6-14(7-9-15)25(30)32-16-10-11-17-21(12-16)33-24(29)18(13-28)22(17)23-19(26)4-3-5-20(23)27/h3-12,22H,2,29H2,1H3 |
| InChIKey | FJEZMLWUAASVOT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|