C36H39FN2O5 — CID 19130064
[2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19130064) has the molecular formula C36H39FN2O5 and a molecular weight of 598.72 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19130064 |
| Molecular Formula | C36H39FN2O5 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(F)cc3)c(OCC)c2)CC1 |
| InChI | InChI=1S/C36H39FN2O5/c1-3-5-6-23-7-11-25(12-8-23)36(40)43-28-16-17-29-32(20-28)44-35(39)30(21-38)34(29)26-13-18-31(33(19-26)41-4-2)42-22-24-9-14-27(37)15-10-24/h9-10,13-20,23,25,34H,3-8,11-12,22,39H2,1-2H3 |
| InChIKey | RVQVOSWOFDEQMX-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|