C18H15BrN2O3 — CID 8613740
(4R)-2-amino-4-(3-bromo-4-methoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile (PubChem CID 8613740) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-bromo-4-methoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3-bromo-4-methoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 8613740 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (4R)-2-amino-4-(3-bromo-4-methoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc2c(c1)OC(N)=C(C#N)[C@@H]2c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C18H15BrN2O3/c1-22-11-4-5-12-16(8-11)24-18(21)13(9-20)17(12)10-3-6-15(23-2)14(19)7-10/h3-8,17H,21H2,1-2H3/t17-/m1/s1 |
| InChIKey | HYMZNPOGXOOFGE-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |