C28H25FN2O4 — CID 19125401
[2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-fluorobenzoate (PubChem CID 19125401) has the molecular formula C28H25FN2O4 and a molecular weight of 472.52 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-fluorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 19125401 |
| Molecular Formula | C28H25FN2O4 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-fluorobenzoate |
| SMILES | CCCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4F)ccc32)c1 |
| InChI | InChI=1S/C28H25FN2O4/c1-2-3-6-14-33-19-9-7-8-18(15-19)26-22-13-12-20(16-25(22)35-27(31)23(26)17-30)34-28(32)21-10-4-5-11-24(21)29/h4-5,7-13,15-16,26H,2-3,6,14,31H2,1H3 |
| InChIKey | BVXAPHQWBGEAST-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|