C30H24N2O3 — CID 19123709
[2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate (PubChem CID 19123709) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 19123709 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
| SMILES | CCc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4cccc5ccccc45)ccc32)cc1 |
| InChI | InChI=1S/C30H24N2O3/c1-2-19-10-12-21(13-11-19)29-25-15-14-23(17-27(25)35-30(32)26(29)18-31)34-28(33)16-22-8-5-7-20-6-3-4-9-24(20)22/h3-15,17,29H,2,16,32H2,1H3 |
| InChIKey | XERGYGNUNPZYPT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|