C32H28N2O4 — CID 19125547
[2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate (PubChem CID 19125547) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 19125547 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
| SMILES | CCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)Cc4cccc5ccccc45)ccc32)c1 |
| InChI | InChI=1S/C32H28N2O4/c1-2-3-16-36-24-12-7-11-23(17-24)31-27-15-14-25(19-29(27)38-32(34)28(31)20-33)37-30(35)18-22-10-6-9-21-8-4-5-13-26(21)22/h4-15,17,19,31H,2-3,16,18,34H2,1H3 |
| InChIKey | UQTAPGODURGNQN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|