C28H26N2O5 — CID 19125120
[2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate (PubChem CID 19125120) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19125120 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 2-(2-methylphenoxy)acetate |
| SMILES | CCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4C)ccc32)c1 |
| InChI | InChI=1S/C28H26N2O5/c1-3-13-32-20-9-6-8-19(14-20)27-22-12-11-21(15-25(22)35-28(30)23(27)16-29)34-26(31)17-33-24-10-5-4-7-18(24)2/h4-12,14-15,27H,3,13,17,30H2,1-2H3 |
| InChIKey | KEUUVIIHHAYUDN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|