C32H25ClN2O5 — CID 19126437
[2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 19126437) has the molecular formula C32H25ClN2O5 and a molecular weight of 553.01 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19126437 |
| Molecular Formula | C32H25ClN2O5 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H25ClN2O5/c1-20-14-23(33)10-13-28(20)38-19-30(36)39-25-11-12-26-29(16-25)40-32(35)27(17-34)31(26)22-8-5-9-24(15-22)37-18-21-6-3-2-4-7-21/h2-16,31H,18-19,35H2,1H3 |
| InChIKey | OHEJWZKFAGGEEC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|