C31H26N2O4 — CID 19122601
(2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3-butoxybenzoate (PubChem CID 19122601) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3-butoxybenzoate.
| Compound Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3-butoxybenzoate |
|---|---|
| PubChem CID | 19122601 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3-butoxybenzoate |
| SMILES | CCCCOc1cccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C31H26N2O4/c1-2-3-16-35-22-11-6-10-21(17-22)31(34)36-23-14-15-26-28(18-23)37-30(33)27(19-32)29(26)25-13-7-9-20-8-4-5-12-24(20)25/h4-15,17-18,29H,2-3,16,33H2,1H3 |
| InChIKey | GQPUWQQVNQSCAQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|