C25H22N2O5 — CID 19122919
[2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 3-propoxybenzoate (PubChem CID 19122919) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 3-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 3-propoxybenzoate |
|---|---|
| PubChem CID | 19122919 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 3-propoxybenzoate |
| SMILES | CCCOc1cccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(C)o2)c1 |
| InChI | InChI=1S/C25H22N2O5/c1-3-11-29-17-6-4-5-16(12-17)25(28)31-18-8-9-19-22(13-18)32-24(27)20(14-26)23(19)21-10-7-15(2)30-21/h4-10,12-13,23H,3,11,27H2,1-2H3 |
| InChIKey | OSPOVNYJQGEYPJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|