C35H25ClN2O4 — CID 19126106
[2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate (PubChem CID 19126106) has the molecular formula C35H25ClN2O4 and a molecular weight of 573.05 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 19126106 |
| Molecular Formula | C35H25ClN2O4 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-naphthalen-1-ylacetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)Cc3cccc4ccccc34)ccc2C1c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C35H25ClN2O4/c36-26-12-8-22(9-13-26)21-40-27-14-10-24(11-15-27)34-30-17-16-28(19-32(30)42-35(38)31(34)20-37)41-33(39)18-25-6-3-5-23-4-1-2-7-29(23)25/h1-17,19,34H,18,21,38H2 |
| InChIKey | GSSQBLLBEXROPM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|