C37H27ClN2O4 — CID 19126132
[2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2,2-diphenylacetate (PubChem CID 19126132) has the molecular formula C37H27ClN2O4 and a molecular weight of 599.09 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2,2-diphenylacetate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 19126132 |
| Molecular Formula | C37H27ClN2O4 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2,2-diphenylacetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)C(c3ccccc3)c3ccccc3)ccc2C1c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C37H27ClN2O4/c38-28-15-11-24(12-16-28)23-42-29-17-13-27(14-18-29)35-31-20-19-30(21-33(31)44-36(40)32(35)22-39)43-37(41)34(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-21,34-35H,23,40H2 |
| InChIKey | GQUONUZTXAZGBQ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|