C34H30N2O5 — CID 19123974
[2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate (PubChem CID 19123974) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate.
| Compound Name | [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 19123974 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(c4ccccc4)c4ccccc4)ccc32)cc1OCC |
| InChI | InChI=1S/C34H30N2O5/c1-3-38-28-18-15-24(19-30(28)39-4-2)32-26-17-16-25(20-29(26)41-33(36)27(32)21-35)40-34(37)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20,31-32H,3-4,36H2,1-2H3 |
| InChIKey | QWIDDPDQUSJHRP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|